C34H33Cl2F2N3O6 — CID 72550234
(2-methoxy-2-oxoethyl) 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate (PubChem CID 72550234) has the molecular formula C34H33Cl2F2N3O6 and a molecular weight of 688.56 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 72550234 |
| Molecular Formula | C34H33Cl2F2N3O6 |
| Molecular Weight | 688.56 g/mol |
| Exact Mass | 687.17 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
| SMILES | COC(=O)COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](C#N)(c3ccc(Cl)cc3F)[C@H]2c2cccc(Cl)c2F)c(OC)c1 |
| InChI | InChI=1S/C34H33Cl2F2N3O6/c1-33(2,3)15-26-34(17-39,21-11-10-19(35)14-23(21)37)28(20-7-6-8-22(36)29(20)38)30(41-26)31(43)40-24-12-9-18(13-25(24)45-4)32(44)47-16-27(42)46-5/h6-14,26,28,30,41H,15-16H2,1-5H3,(H,40,43)/t26-,28-,30+,34-/m0/s1 |
| InChIKey | VHPZGDOXJPWLFQ-PAEDPNNGSA-N |
| XLogP | 6.57 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |