C32H32Cl2F2N4O3 — CID 160836577
(2R,3S,4R,5S)-N-[4-(2-aminoacetyl)-2-methoxyphenyl]-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide (PubChem CID 160836577) has the molecular formula C32H32Cl2F2N4O3 and a molecular weight of 629.54 g/mol. Its IUPAC name is (2R,3S,4R,5S)-N-[4-(2-aminoacetyl)-2-methoxyphenyl]-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-N-[4-(2-aminoacetyl)-2-methoxyphenyl]-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 160836577 |
| Molecular Formula | C32H32Cl2F2N4O3 |
| Molecular Weight | 629.54 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | (2R,3S,4R,5S)-N-[4-(2-aminoacetyl)-2-methoxyphenyl]-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cc(C(=O)CN)ccc1NC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H32Cl2F2N4O3/c1-31(2,3)14-26-32(16-38,20-10-9-18(33)13-22(20)35)27(19-6-5-7-21(34)28(19)36)29(40-26)30(42)39-23-11-8-17(24(41)15-37)12-25(23)43-4/h5-13,26-27,29,40H,14-15,37H2,1-4H3,(H,39,42)/t26-,27-,29+,32-/m0/s1 |
| InChIKey | SHMHQRCFIBMLJP-DOHZKUFZSA-N |
| XLogP | 6.38 |
| TPSA | 117.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.54 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |