C29H35Cl2F2N3O3 — CID 158395978
(2S,3R,4S,5R)-2-(4-amino-2,2-dimethylbutyl)-4-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-5-[(5S)-5,6-dihydroxyhexanoyl]pyrrolidine-3-carbonitrile (PubChem CID 158395978) has the molecular formula C29H35Cl2F2N3O3 and a molecular weight of 582.52 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2-(4-amino-2,2-dimethylbutyl)-4-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-5-[(5S)-5,6-dihydroxyhexanoyl]pyrrolidine-3-carbonitrile.
| Compound Name | (2S,3R,4S,5R)-2-(4-amino-2,2-dimethylbutyl)-4-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-5-[(5S)-5,6-dihydroxyhexanoyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 158395978 |
| Molecular Formula | C29H35Cl2F2N3O3 |
| Molecular Weight | 582.52 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | (2S,3R,4S,5R)-2-(4-amino-2,2-dimethylbutyl)-4-(3-chloro-2-fluorophenyl)-3-(4-chloro-2-fluorophenyl)-5-[(5S)-5,6-dihydroxyhexanoyl]pyrrolidine-3-carbonitrile |
| SMILES | CC(C)(CCN)C[C@@H]1N[C@@H](C(=O)CCC[C@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C29H35Cl2F2N3O3/c1-28(2,11-12-34)14-24-29(16-35,20-10-9-17(30)13-22(20)32)25(19-6-4-7-21(31)26(19)33)27(36-24)23(39)8-3-5-18(38)15-37/h4,6-7,9-10,13,18,24-25,27,36-38H,3,5,8,11-12,14-15,34H2,1-2H3/t18-,24-,25-,27-,29-/m0/s1 |
| InChIKey | GXNXXQGSIWBEJS-WCGQRESVSA-N |
| XLogP | 5.01 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |