C28H34Cl2F2N4O3 — CID 59249466
(2R,3S,4R,5S)-5-(4-amino-2,2-dimethylbutyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide (PubChem CID 59249466) has the molecular formula C28H34Cl2F2N4O3 and a molecular weight of 583.51 g/mol. Its IUPAC name is (2R,3S,4R,5S)-5-(4-amino-2,2-dimethylbutyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-5-(4-amino-2,2-dimethylbutyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59249466 |
| Molecular Formula | C28H34Cl2F2N4O3 |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | (2R,3S,4R,5S)-5-(4-amino-2,2-dimethylbutyl)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(CCN)C[C@@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2F)[C@@]1(C#N)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C28H34Cl2F2N4O3/c1-27(2,9-10-33)13-22-28(15-34,19-7-6-16(29)12-21(19)31)23(18-4-3-5-20(30)24(18)32)25(36-22)26(39)35-11-8-17(38)14-37/h3-7,12,17,22-23,25,36-38H,8-11,13-14,33H2,1-2H3,(H,35,39)/t17-,22-,23-,25+,28-/m0/s1 |
| InChIKey | JGUAOMDMMFDIBF-BNTMEESMSA-N |
| XLogP | 3.78 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |