C27H29Cl2F2N3O4 — CID 67297164
(2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(1-cyclopropyl-2-hydroxyethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide (PubChem CID 67297164) has the molecular formula C27H29Cl2F2N3O4 and a molecular weight of 568.45 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(1-cyclopropyl-2-hydroxyethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(1-cyclopropyl-2-hydroxyethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67297164 |
| Molecular Formula | C27H29Cl2F2N3O4 |
| Molecular Weight | 568.45 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | (2S,3R,4S,5R)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(1-cyclopropyl-2-hydroxyethyl)-N-[(3S)-3,4-dihydroxybutyl]pyrrolidine-2-carboxamide |
| SMILES | N#C[C@@]1(c2ccc(Cl)cc2F)[C@@H](C(CO)C2CC2)N[C@H](C(=O)NCC[C@H](O)CO)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C27H29Cl2F2N3O4/c28-15-6-7-19(21(30)10-15)27(13-32)22(17-2-1-3-20(29)23(17)31)24(26(38)33-9-8-16(37)11-35)34-25(27)18(12-36)14-4-5-14/h1-3,6-7,10,14,16,18,22,24-25,34-37H,4-5,8-9,11-12H2,(H,33,38)/t16-,18?,22+,24-,25+,27-/m0/s1 |
| InChIKey | NEWLFDMQGVUHGE-NURBQBDBSA-N |
| XLogP | 3.04 |
| TPSA | 125.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |