C27H33Cl2F2N3O4 — CID 70237229
(2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 70237229) has the molecular formula C27H33Cl2F2N3O4 and a molecular weight of 572.48 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70237229 |
| Molecular Formula | C27H33Cl2F2N3O4 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | (2R,3S,4R,5S)-4-amino-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-(oxan-4-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | N[C@]1(c2ccc(Cl)cc2F)[C@H](CC2CCOCC2)N[C@@H](C(=O)NCC[C@H](O)CO)[C@@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C27H33Cl2F2N3O4/c28-16-4-5-19(21(30)13-16)27(32)22(12-15-7-10-38-11-8-15)34-25(26(37)33-9-6-17(36)14-35)23(27)18-2-1-3-20(29)24(18)31/h1-5,13,15,17,22-23,25,34-36H,6-12,14,32H2,(H,33,37)/t17-,22-,23-,25+,27+/m0/s1 |
| InChIKey | GJXRMTWBIFJFRV-XKKQFILZSA-N |
| XLogP | 3.23 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |