C29H38Cl2N4O2 — CID 129059257
(2R,3R,4S)-4-[(1R)-4-chlorocyclohexa-2,4-dien-1-yl]-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 129059257) has the molecular formula C29H38Cl2N4O2 and a molecular weight of 545.56 g/mol. Its IUPAC name is (2R,3R,4S)-4-[(1R)-4-chlorocyclohexa-2,4-dien-1-yl]-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3R,4S)-4-[(1R)-4-chlorocyclohexa-2,4-dien-1-yl]-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129059257 |
| Molecular Formula | C29H38Cl2N4O2 |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | (2R,3R,4S)-4-[(1R)-4-chlorocyclohexa-2,4-dien-1-yl]-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)CC1N[C@@H](C(=O)NCCN2CCOCC2)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)[C@H]1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C29H38Cl2N4O2/c1-28(2,3)18-24-29(19-32,21-7-9-22(30)10-8-21)25(20-5-4-6-23(31)17-20)26(34-24)27(36)33-11-12-35-13-15-37-16-14-35/h4-7,9-10,17,21,24-26,34H,8,11-16,18H2,1-3H3,(H,33,36)/t21-,24?,25-,26+,29-/m0/s1 |
| InChIKey | AKYNGITVJDJFQR-XRNADNIMSA-N |
| XLogP | 4.86 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |