C28H40Cl2N4O2 — CID 143958695
(2R,3S,4S,5S)-4-amino-4-(4-chlorocyclohexa-2,4-dien-1-yl)-3-(3-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide (PubChem CID 143958695) has the molecular formula C28H40Cl2N4O2 and a molecular weight of 535.56 g/mol. Its IUPAC name is (2R,3S,4S,5S)-4-amino-4-(4-chlorocyclohexa-2,4-dien-1-yl)-3-(3-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,3S,4S,5S)-4-amino-4-(4-chlorocyclohexa-2,4-dien-1-yl)-3-(3-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143958695 |
| Molecular Formula | C28H40Cl2N4O2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | (2R,3S,4S,5S)-4-amino-4-(4-chlorocyclohexa-2,4-dien-1-yl)-3-(3-chlorophenyl)-5-(2,2-dimethylpropyl)-N-(2-morpholin-4-ylethyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)NCCN2CCOCC2)[C@H](c2cccc(Cl)c2)[C@@]1(N)C1C=CC(Cl)=CC1 |
| InChI | InChI=1S/C28H40Cl2N4O2/c1-27(2,3)18-23-28(31,20-7-9-21(29)10-8-20)24(19-5-4-6-22(30)17-19)25(33-23)26(35)32-11-12-34-13-15-36-16-14-34/h4-7,9-10,17,20,23-25,33H,8,11-16,18,31H2,1-3H3,(H,32,35)/t20?,23-,24-,25+,28+/m0/s1 |
| InChIKey | NKBDMIJMSOLCPV-ZFGHIKKNSA-N |
| XLogP | 4.04 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |