C21H22N2O4S — CID 162648327
N-[(3Z)-3-(cyclopentylmethylidene)-2-oxo-1H-indol-5-yl]-2-methoxybenzenesulfonamide (PubChem CID 162648327) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-[(3Z)-3-(cyclopentylmethylidene)-2-oxo-1H-indol-5-yl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[(3Z)-3-(cyclopentylmethylidene)-2-oxo-1H-indol-5-yl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 162648327 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[(3Z)-3-(cyclopentylmethylidene)-2-oxo-1H-indol-5-yl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)Nc1ccc2c(c1)/C(=C/C1CCCC1)C(=O)N2 |
| InChI | InChI=1S/C21H22N2O4S/c1-27-19-8-4-5-9-20(19)28(25,26)23-15-10-11-18-16(13-15)17(21(24)22-18)12-14-6-2-3-7-14/h4-5,8-14,23H,2-3,6-7H2,1H3,(H,22,24)/b17-12- |
| InChIKey | FCQMHJLCPWZWQJ-ATVHPVEESA-N |
| XLogP | 4.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|