C30H21N5O4 — CID 75539356
4-[(4Z)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-N-(2-methyl-4-oxoquinazolin-3-yl)benzamide (PubChem CID 75539356) has the molecular formula C30H21N5O4 and a molecular weight of 515.53 g/mol. Its IUPAC name is 4-[(4Z)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-N-(2-methyl-4-oxoquinazolin-3-yl)benzamide.
| Compound Name | 4-[(4Z)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-N-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
|---|---|
| PubChem CID | 75539356 |
| Molecular Formula | C30H21N5O4 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 4-[(4Z)-4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-N-(2-methyl-4-oxoquinazolin-3-yl)benzamide |
| SMILES | Cc1nc2ccccc2c(=O)n1NC(=O)c1ccc(N2C(=O)/C(=C/c3ccco3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C30H21N5O4/c1-19-31-25-12-6-5-11-24(25)29(37)35(19)33-28(36)21-13-15-22(16-14-21)34-27(20-8-3-2-4-9-20)32-26(30(34)38)18-23-10-7-17-39-23/h2-18H,1H3,(H,33,36)/b26-18- |
| InChIKey | LMPRRLZEJBTWJU-ITYLOYPMSA-N |
| XLogP | 4.52 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|