C26H25N3O4 — CID 1274877
2-(4-ethoxyphenyl)-N-[4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-2-methylpropanamide (PubChem CID 1274877) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-2-methylpropanamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 1274877 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[4-(furan-2-ylmethylidene)-5-oxo-2-phenylimidazol-1-yl]-2-methylpropanamide |
| SMILES | CCOc1ccc(C(C)(C)C(=O)NN2C(=O)C(=Cc3ccco3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O4/c1-4-32-20-14-12-19(13-15-20)26(2,3)25(31)28-29-23(18-9-6-5-7-10-18)27-22(24(29)30)17-21-11-8-16-33-21/h5-17H,4H2,1-3H3,(H,28,31) |
| InChIKey | WRDICSPQUKRMGX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|