C33H24N8O3 — CID 1275624
N-[4-benzamido-6-[[(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl]amino]-1,3,5-triazin-2-yl]benzamide (PubChem CID 1275624) has the molecular formula C33H24N8O3 and a molecular weight of 580.61 g/mol. Its IUPAC name is N-[4-benzamido-6-[[(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl]amino]-1,3,5-triazin-2-yl]benzamide.
| Compound Name | N-[4-benzamido-6-[[(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl]amino]-1,3,5-triazin-2-yl]benzamide |
|---|---|
| PubChem CID | 1275624 |
| Molecular Formula | C33H24N8O3 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | N-[4-benzamido-6-[[(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl]amino]-1,3,5-triazin-2-yl]benzamide |
| SMILES | O=C(Nc1nc(NC(=O)c2ccccc2)nc(NN2C(=O)/C(=C/c3ccccc3)N=C2c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C33H24N8O3/c42-28(24-17-9-3-10-18-24)35-31-37-32(36-29(43)25-19-11-4-12-20-25)39-33(38-31)40-41-27(23-15-7-2-8-16-23)34-26(30(41)44)21-22-13-5-1-6-14-22/h1-21H,(H3,35,36,37,38,39,40,42,43)/b26-21- |
| InChIKey | NGWNQEIQWBVDJF-QLYXXIJNSA-N |
| XLogP | 5.03 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|