C26H21N3O3 — CID 5471598
(5Z)-3-(4-methoxyanilino)-5-[(E)-2-oxo-4-phenylbut-3-enylidene]-2-phenylimidazol-4-one (PubChem CID 5471598) has the molecular formula C26H21N3O3 and a molecular weight of 423.47 g/mol. Its IUPAC name is (5Z)-3-(4-methoxyanilino)-5-[(E)-2-oxo-4-phenylbut-3-enylidene]-2-phenylimidazol-4-one.
| Compound Name | (5Z)-3-(4-methoxyanilino)-5-[(E)-2-oxo-4-phenylbut-3-enylidene]-2-phenylimidazol-4-one |
|---|---|
| PubChem CID | 5471598 |
| Molecular Formula | C26H21N3O3 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (5Z)-3-(4-methoxyanilino)-5-[(E)-2-oxo-4-phenylbut-3-enylidene]-2-phenylimidazol-4-one |
| SMILES | COc1ccc(NN2C(=O)/C(=C/C(=O)/C=C/c3ccccc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O3/c1-32-23-16-13-21(14-17-23)28-29-25(20-10-6-3-7-11-20)27-24(26(29)31)18-22(30)15-12-19-8-4-2-5-9-19/h2-18,28H,1H3/b15-12+,24-18- |
| InChIKey | ZDQSKUKTGDBHAC-ICJAMGLRSA-N |
| XLogP | 4.48 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|