C22H20Cl4N4O2 — CID 6294282
2,4,4,4-tetrachloro-N-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]butanamide (PubChem CID 6294282) has the molecular formula C22H20Cl4N4O2 and a molecular weight of 514.24 g/mol. Its IUPAC name is 2,4,4,4-tetrachloro-N-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]butanamide.
| Compound Name | 2,4,4,4-tetrachloro-N-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]butanamide |
|---|---|
| PubChem CID | 6294282 |
| Molecular Formula | C22H20Cl4N4O2 |
| Molecular Weight | 514.24 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 2,4,4,4-tetrachloro-N-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]butanamide |
| SMILES | CN(C)c1ccc(/C=C2\N=C(c3ccccc3)N(NC(=O)C(Cl)CC(Cl)(Cl)Cl)C2=O)cc1 |
| InChI | InChI=1S/C22H20Cl4N4O2/c1-29(2)16-10-8-14(9-11-16)12-18-21(32)30(19(27-18)15-6-4-3-5-7-15)28-20(31)17(23)13-22(24,25)26/h3-12,17H,13H2,1-2H3,(H,28,31)/b18-12- |
| InChIKey | BMQWPGJZQIEROB-PDGQHHTCSA-N |
| XLogP | 4.78 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|