C28H29N5O2 — CID 10096137
2-amino-N-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-2-methyl-5-oxoimidazol-1-yl]phenyl]-3-phenylpropanamide (PubChem CID 10096137) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-amino-N-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-2-methyl-5-oxoimidazol-1-yl]phenyl]-3-phenylpropanamide.
| Compound Name | 2-amino-N-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-2-methyl-5-oxoimidazol-1-yl]phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 10096137 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 2-amino-N-[2-[(4Z)-4-[[4-(dimethylamino)phenyl]methylidene]-2-methyl-5-oxoimidazol-1-yl]phenyl]-3-phenylpropanamide |
| SMILES | CC1=N/C(=C\c2ccc(N(C)C)cc2)C(=O)N1c1ccccc1NC(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C28H29N5O2/c1-19-30-25(18-21-13-15-22(16-14-21)32(2)3)28(35)33(19)26-12-8-7-11-24(26)31-27(34)23(29)17-20-9-5-4-6-10-20/h4-16,18,23H,17,29H2,1-3H3,(H,31,34)/b25-18- |
| InChIKey | DFJUOKFZWKLRST-BWAHOGKJSA-N |
| XLogP | 4.07 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|