C32H22N2O8S2 — CID 3709834
2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid (PubChem CID 3709834) has the molecular formula C32H22N2O8S2 and a molecular weight of 626.67 g/mol. Its IUPAC name is 2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 3709834 |
| Molecular Formula | C32H22N2O8S2 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 2-[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]naphthalene-1,5-disulfonic acid |
| SMILES | O=C1C(=Cc2cccc(Oc3ccccc3)c2)N=C(c2ccccc2)N1c1ccc2c(S(=O)(=O)O)cccc2c1S(=O)(=O)O |
| InChI | InChI=1S/C32H22N2O8S2/c35-32-27(20-21-9-7-14-24(19-21)42-23-12-5-2-6-13-23)33-31(22-10-3-1-4-11-22)34(32)28-18-17-25-26(30(28)44(39,40)41)15-8-16-29(25)43(36,37)38/h1-20H,(H,36,37,38)(H,39,40,41) |
| InChIKey | ATANGRIGWTWTCV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 150.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|