C35H24N4O2S — CID 135518444
5-[(3-phenoxyphenyl)methylidene]-2-phenyl-3-(5-phenylsulfanyl-1H-benzimidazol-2-yl)imidazol-4-one (PubChem CID 135518444) has the molecular formula C35H24N4O2S and a molecular weight of 564.67 g/mol. Its IUPAC name is 5-[(3-phenoxyphenyl)methylidene]-2-phenyl-3-(5-phenylsulfanyl-1H-benzimidazol-2-yl)imidazol-4-one.
| Compound Name | 5-[(3-phenoxyphenyl)methylidene]-2-phenyl-3-(5-phenylsulfanyl-1H-benzimidazol-2-yl)imidazol-4-one |
|---|---|
| PubChem CID | 135518444 |
| Molecular Formula | C35H24N4O2S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | 5-[(3-phenoxyphenyl)methylidene]-2-phenyl-3-(5-phenylsulfanyl-1H-benzimidazol-2-yl)imidazol-4-one |
| SMILES | O=C1C(=Cc2cccc(Oc3ccccc3)c2)N=C(c2ccccc2)N1c1nc2cc(Sc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C35H24N4O2S/c40-34-32(22-24-11-10-16-27(21-24)41-26-14-6-2-7-15-26)36-33(25-12-4-1-5-13-25)39(34)35-37-30-20-19-29(23-31(30)38-35)42-28-17-8-3-9-18-28/h1-23H,(H,37,38) |
| InChIKey | BOJMXVPKBXNPOW-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 70.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|