C30H20N4O3 — CID 3576922
3-[[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]amino]indol-2-one (PubChem CID 3576922) has the molecular formula C30H20N4O3 and a molecular weight of 484.52 g/mol. Its IUPAC name is 3-[[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]amino]indol-2-one.
| Compound Name | 3-[[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]amino]indol-2-one |
|---|---|
| PubChem CID | 3576922 |
| Molecular Formula | C30H20N4O3 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 3-[[5-oxo-4-[(3-phenoxyphenyl)methylidene]-2-phenylimidazol-1-yl]amino]indol-2-one |
| SMILES | O=C1N=c2ccccc2=C1NN1C(=O)C(=Cc2cccc(Oc3ccccc3)c2)N=C1c1ccccc1 |
| InChI | InChI=1S/C30H20N4O3/c35-29-27(24-16-7-8-17-25(24)32-29)33-34-28(21-11-3-1-4-12-21)31-26(30(34)36)19-20-10-9-15-23(18-20)37-22-13-5-2-6-14-22/h1-19H,(H,32,33,35) |
| InChIKey | JNQKRMTWNAEYSS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|