C22H16N2O4S2 — CID 3674032
4-[5-oxo-2-phenyl-4-[(2-sulfanylphenyl)methylidene]imidazol-1-yl]benzenesulfonic acid (PubChem CID 3674032) has the molecular formula C22H16N2O4S2 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[5-oxo-2-phenyl-4-[(2-sulfanylphenyl)methylidene]imidazol-1-yl]benzenesulfonic acid.
| Compound Name | 4-[5-oxo-2-phenyl-4-[(2-sulfanylphenyl)methylidene]imidazol-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 3674032 |
| Molecular Formula | C22H16N2O4S2 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 4-[5-oxo-2-phenyl-4-[(2-sulfanylphenyl)methylidene]imidazol-1-yl]benzenesulfonic acid |
| SMILES | O=C1C(=Cc2ccccc2S)N=C(c2ccccc2)N1c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C22H16N2O4S2/c25-22-19(14-16-8-4-5-9-20(16)29)23-21(15-6-2-1-3-7-15)24(22)17-10-12-18(13-11-17)30(26,27)28/h1-14,29H,(H,26,27,28) |
| InChIKey | YNCNZKNNUSGILP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|