C21H20ClN3O2Se — CID 11751543
(5Z)-3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methylidene]-2-selenomorpholin-4-ylimidazol-4-one (PubChem CID 11751543) has the molecular formula C21H20ClN3O2Se and a molecular weight of 460.82 g/mol. Its IUPAC name is (5Z)-3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methylidene]-2-selenomorpholin-4-ylimidazol-4-one.
| Compound Name | (5Z)-3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methylidene]-2-selenomorpholin-4-ylimidazol-4-one |
|---|---|
| PubChem CID | 11751543 |
| Molecular Formula | C21H20ClN3O2Se |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | (5Z)-3-(4-chlorophenyl)-5-[(4-methoxyphenyl)methylidene]-2-selenomorpholin-4-ylimidazol-4-one |
| SMILES | COc1ccc(/C=C2\N=C(N3CC[Se]CC3)N(c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H20ClN3O2Se/c1-27-18-8-2-15(3-9-18)14-19-20(26)25(17-6-4-16(22)5-7-17)21(23-19)24-10-12-28-13-11-24/h2-9,14H,10-13H2,1H3/b19-14- |
| InChIKey | KBWLJUIJVKKQKU-RGEXLXHISA-N |
| XLogP | 3.95 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|