C21H21N3O2Se — CID 11224062
(5Z)-5-[(4-methoxyphenyl)methylidene]-3-phenyl-2-selenomorpholin-4-ylimidazol-4-one (PubChem CID 11224062) has the molecular formula C21H21N3O2Se and a molecular weight of 426.38 g/mol. Its IUPAC name is (5Z)-5-[(4-methoxyphenyl)methylidene]-3-phenyl-2-selenomorpholin-4-ylimidazol-4-one.
| Compound Name | (5Z)-5-[(4-methoxyphenyl)methylidene]-3-phenyl-2-selenomorpholin-4-ylimidazol-4-one |
|---|---|
| PubChem CID | 11224062 |
| Molecular Formula | C21H21N3O2Se |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | (5Z)-5-[(4-methoxyphenyl)methylidene]-3-phenyl-2-selenomorpholin-4-ylimidazol-4-one |
| SMILES | COc1ccc(/C=C2\N=C(N3CC[Se]CC3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N3O2Se/c1-26-18-9-7-16(8-10-18)15-19-20(25)24(17-5-3-2-4-6-17)21(22-19)23-11-13-27-14-12-23/h2-10,15H,11-14H2,1H3/b19-15- |
| InChIKey | WQIXDLOAAUJEHG-CYVLTUHYSA-N |
| XLogP | 3.30 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|