C20H17N5O2 — CID 56690464
(5E)-5-[(4-methoxyphenyl)methylidene]-3-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)imidazol-4-one (PubChem CID 56690464) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is (5E)-5-[(4-methoxyphenyl)methylidene]-3-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)imidazol-4-one.
| Compound Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)imidazol-4-one |
|---|---|
| PubChem CID | 56690464 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (5E)-5-[(4-methoxyphenyl)methylidene]-3-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)imidazol-4-one |
| SMILES | COc1ccc(/C=C2/N=C(n3cncn3)N(c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H17N5O2/c1-14-3-7-16(8-4-14)25-19(26)18(23-20(25)24-13-21-12-22-24)11-15-5-9-17(27-2)10-6-15/h3-13H,1-2H3/b18-11+ |
| InChIKey | AKGFYRPTEPOOFR-WOJGMQOQSA-N |
| XLogP | 2.89 |
| TPSA | 72.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|