C19H17N2O3Se — CID 155758715
CID 155758715 (PubChem CID 155758715) has the molecular formula C19H17N2O3Se and a molecular weight of 400.32 g/mol.
| Compound Name | CID 155758715 |
|---|---|
| PubChem CID | 155758715 |
| Molecular Formula | C19H17N2O3Se |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | — |
| SMILES | CCOc1ccc(/C=C2\N=C([Se])N(c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H17N2O3Se/c1-3-24-16-8-4-13(5-9-16)12-17-18(22)21(19(25)20-17)14-6-10-15(23-2)11-7-14/h4-12H,3H2,1-2H3/b17-12- |
| InChIKey | DVHLRHKPQSQJMC-ATVHPVEESA-N |
| XLogP | 3.01 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|