C24H27N3O3S — CID 46246841
(5Z)-3-(4-ethoxyphenyl)-2-ethylsulfanyl-5-[(4-morpholin-4-ylphenyl)methylidene]imidazol-4-one (PubChem CID 46246841) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is (5Z)-3-(4-ethoxyphenyl)-2-ethylsulfanyl-5-[(4-morpholin-4-ylphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-3-(4-ethoxyphenyl)-2-ethylsulfanyl-5-[(4-morpholin-4-ylphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 46246841 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | (5Z)-3-(4-ethoxyphenyl)-2-ethylsulfanyl-5-[(4-morpholin-4-ylphenyl)methylidene]imidazol-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C/c3ccc(N4CCOCC4)cc3)N=C2SCC)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-3-30-21-11-9-20(10-12-21)27-23(28)22(25-24(27)31-4-2)17-18-5-7-19(8-6-18)26-13-15-29-16-14-26/h5-12,17H,3-4,13-16H2,1-2H3/b22-17- |
| InChIKey | ZMMBZRJGPMUKPH-XLNRJJMWSA-N |
| XLogP | 4.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|