C30H28F2N4O5S — CID 5206939
2-[1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)acetamide (PubChem CID 5206939) has the molecular formula C30H28F2N4O5S and a molecular weight of 594.64 g/mol. Its IUPAC name is 2-[1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 5206939 |
| Molecular Formula | C30H28F2N4O5S |
| Molecular Weight | 594.64 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | 2-[1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanyl-N-(4-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1ccc(C=C2N=C(SCC(=O)Nc3ccc(N4CCOCC4)cc3)N(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H28F2N4O5S/c1-39-24-10-2-20(3-11-24)18-26-28(38)36(23-8-12-25(13-9-23)41-29(31)32)30(34-26)42-19-27(37)33-21-4-6-22(7-5-21)35-14-16-40-17-15-35/h2-13,18,29H,14-17,19H2,1H3,(H,33,37) |
| InChIKey | AQIFKXZUNCNORC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|