C24H24F2N4O3S — CID 39522930
(5Z)-2-[2-(azetidin-1-yl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]imidazol-4-one (PubChem CID 39522930) has the molecular formula C24H24F2N4O3S and a molecular weight of 486.54 g/mol. Its IUPAC name is (5Z)-2-[2-(azetidin-1-yl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]imidazol-4-one.
| Compound Name | (5Z)-2-[2-(azetidin-1-yl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 39522930 |
| Molecular Formula | C24H24F2N4O3S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | (5Z)-2-[2-(azetidin-1-yl)-2-oxoethyl]sulfanyl-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]imidazol-4-one |
| SMILES | CN(C)c1ccc(/C=C2\N=C(SCC(=O)N3CCC3)N(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H24F2N4O3S/c1-28(2)17-6-4-16(5-7-17)14-20-22(32)30(18-8-10-19(11-9-18)33-23(25)26)24(27-20)34-15-21(31)29-12-3-13-29/h4-11,14,23H,3,12-13,15H2,1-2H3/b20-14- |
| InChIKey | IOIXENKFWNLBMC-ZHZULCJRSA-N |
| XLogP | 4.06 |
| TPSA | 65.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|