C24H25F2N3O4S — CID 2126935
N-butyl-2-[(4Z)-1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide (PubChem CID 2126935) has the molecular formula C24H25F2N3O4S and a molecular weight of 489.54 g/mol. Its IUPAC name is N-butyl-2-[(4Z)-1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-butyl-2-[(4Z)-1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2126935 |
| Molecular Formula | C24H25F2N3O4S |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-butyl-2-[(4Z)-1-[4-(difluoromethoxy)phenyl]-4-[(4-methoxyphenyl)methylidene]-5-oxoimidazol-2-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)CSC1=N/C(=C\c2ccc(OC)cc2)C(=O)N1c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H25F2N3O4S/c1-3-4-13-27-21(30)15-34-24-28-20(14-16-5-9-18(32-2)10-6-16)22(31)29(24)17-7-11-19(12-8-17)33-23(25)26/h5-12,14,23H,3-4,13,15H2,1-2H3,(H,27,30)/b20-14- |
| InChIKey | MREYKIKFYLBEQT-ZHZULCJRSA-N |
| XLogP | 4.69 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|