C25H27F2N3O3S — CID 42966839
(5Z)-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]-2-(oxan-2-ylmethylsulfanyl)imidazol-4-one (PubChem CID 42966839) has the molecular formula C25H27F2N3O3S and a molecular weight of 487.57 g/mol. Its IUPAC name is (5Z)-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]-2-(oxan-2-ylmethylsulfanyl)imidazol-4-one.
| Compound Name | (5Z)-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]-2-(oxan-2-ylmethylsulfanyl)imidazol-4-one |
|---|---|
| PubChem CID | 42966839 |
| Molecular Formula | C25H27F2N3O3S |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (5Z)-3-[4-(difluoromethoxy)phenyl]-5-[[4-(dimethylamino)phenyl]methylidene]-2-(oxan-2-ylmethylsulfanyl)imidazol-4-one |
| SMILES | CN(C)c1ccc(/C=C2\N=C(SCC3CCCCO3)N(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H27F2N3O3S/c1-29(2)18-8-6-17(7-9-18)15-22-23(31)30(19-10-12-20(13-11-19)33-24(26)27)25(28-22)34-16-21-5-3-4-14-32-21/h6-13,15,21,24H,3-5,14,16H2,1-2H3/b22-15- |
| InChIKey | CWMWJNWNIOPGKB-JCMHNJIXSA-N |
| XLogP | 5.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|