C26H30N2O2S — CID 6381865
(5Z)-3-(4-methylphenyl)-2-(oxan-2-ylmethylsulfanyl)-5-[(4-propan-2-ylphenyl)methylidene]imidazol-4-one (PubChem CID 6381865) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is (5Z)-3-(4-methylphenyl)-2-(oxan-2-ylmethylsulfanyl)-5-[(4-propan-2-ylphenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-3-(4-methylphenyl)-2-(oxan-2-ylmethylsulfanyl)-5-[(4-propan-2-ylphenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 6381865 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (5Z)-3-(4-methylphenyl)-2-(oxan-2-ylmethylsulfanyl)-5-[(4-propan-2-ylphenyl)methylidene]imidazol-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C/c3ccc(C(C)C)cc3)N=C2SCC2CCCCO2)cc1 |
| InChI | InChI=1S/C26H30N2O2S/c1-18(2)21-11-9-20(10-12-21)16-24-25(29)28(22-13-7-19(3)8-14-22)26(27-24)31-17-23-6-4-5-15-30-23/h7-14,16,18,23H,4-6,15,17H2,1-3H3/b24-16- |
| InChIKey | QVCHORBSQKEPHF-JLPGSUDCSA-N |
| XLogP | 6.16 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|