C20H15N5O2 — CID 164576821
2-[(5E)-5-[(4-methoxyphenyl)methylidene]-6-oxo-3-phenylimidazo[1,2-b][1,2,4]triazol-2-yl]acetonitrile (PubChem CID 164576821) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 2-[(5E)-5-[(4-methoxyphenyl)methylidene]-6-oxo-3-phenylimidazo[1,2-b][1,2,4]triazol-2-yl]acetonitrile.
| Compound Name | 2-[(5E)-5-[(4-methoxyphenyl)methylidene]-6-oxo-3-phenylimidazo[1,2-b][1,2,4]triazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 164576821 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[(5E)-5-[(4-methoxyphenyl)methylidene]-6-oxo-3-phenylimidazo[1,2-b][1,2,4]triazol-2-yl]acetonitrile |
| SMILES | COc1ccc(/C=C2/N=C3N(N=C(CC#N)N3c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C20H15N5O2/c1-27-16-9-7-14(8-10-16)13-17-19(26)25-20(22-17)24(18(23-25)11-12-21)15-5-3-2-4-6-15/h2-10,13H,11H2,1H3/b17-13+ |
| InChIKey | KUSPSQGRSJAEFG-GHRIWEEISA-N |
| XLogP | 2.98 |
| TPSA | 81.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|