C20H19ClN2O2 — CID 136895494
(4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(3-methylphenyl)ethyl]-1H-imidazol-5-one (PubChem CID 136895494) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(3-methylphenyl)ethyl]-1H-imidazol-5-one.
| Compound Name | (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(3-methylphenyl)ethyl]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136895494 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (4E)-4-[(5-chloro-2-methoxyphenyl)methylidene]-2-[2-(3-methylphenyl)ethyl]-1H-imidazol-5-one |
| SMILES | COc1ccc(Cl)cc1/C=C1/N=C(CCc2cccc(C)c2)NC1=O |
| InChI | InChI=1S/C20H19ClN2O2/c1-13-4-3-5-14(10-13)6-9-19-22-17(20(24)23-19)12-15-11-16(21)7-8-18(15)25-2/h3-5,7-8,10-12H,6,9H2,1-2H3,(H,22,23,24)/b17-12+ |
| InChIKey | DUHMUNZWAQKWBU-SFQUDFHCSA-N |
| XLogP | 4.16 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|