C21H21FN2O4 — CID 136894586
(4E)-2-[2-(2-fluorophenyl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one (PubChem CID 136894586) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is (4E)-2-[2-(2-fluorophenyl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one.
| Compound Name | (4E)-2-[2-(2-fluorophenyl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
|---|---|
| PubChem CID | 136894586 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | (4E)-2-[2-(2-fluorophenyl)ethyl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-1H-imidazol-5-one |
| SMILES | COc1cc(/C=C2/N=C(CCc3ccccc3F)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H21FN2O4/c1-26-17-11-13(12-18(27-2)20(17)28-3)10-16-21(25)24-19(23-16)9-8-14-6-4-5-7-15(14)22/h4-7,10-12H,8-9H2,1-3H3,(H,23,24,25)/b16-10+ |
| InChIKey | CRFWBXLTSZTYFO-MHWRWJLKSA-N |
| XLogP | 3.35 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|