C16H10ClN3O5S — CID 21208573
N-[(5Z)-5-[[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 21208573) has the molecular formula C16H10ClN3O5S and a molecular weight of 391.79 g/mol. Its IUPAC name is N-[(5Z)-5-[[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5Z)-5-[[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 21208573 |
| Molecular Formula | C16H10ClN3O5S |
| Molecular Weight | 391.79 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | N-[(5Z)-5-[[5-(5-chloro-2-nitrophenyl)furan-2-yl]methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C/c2ccc(-c3cc(Cl)ccc3[N+](=O)[O-])o2)S1 |
| InChI | InChI=1S/C16H10ClN3O5S/c1-8(21)18-16-19-15(22)14(26-16)7-10-3-5-13(25-10)11-6-9(17)2-4-12(11)20(23)24/h2-7H,1H3,(H,18,19,21,22)/b14-7- |
| InChIKey | OTACFYFJKIZRKA-AUWJEWJLSA-N |
| XLogP | 3.61 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|