C13H14N2O4S — CID 52997289
acetic acid;(5E)-2-amino-5-[(4-methoxyphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 52997289) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is acetic acid;(5E)-2-amino-5-[(4-methoxyphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | acetic acid;(5E)-2-amino-5-[(4-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 52997289 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | acetic acid;(5E)-2-amino-5-[(4-methoxyphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | CC(=O)O.COc1ccc(/C=C2/SC(N)=NC2=O)cc1 |
| InChI | InChI=1S/C11H10N2O2S.C2H4O2/c1-15-8-4-2-7(3-5-8)6-9-10(14)13-11(12)16-9;1-2(3)4/h2-6H,1H3,(H2,12,13,14);1H3,(H,3,4)/b9-6+; |
| InChIKey | ZUJZHMQEIRNGET-MLBSPLJJSA-N |
| XLogP | 1.72 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|