C15H16FN3OS — CID 3942490
2-amino-5-[(3-fluoro-4-piperidin-1-ylphenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 3942490) has the molecular formula C15H16FN3OS and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-amino-5-[(3-fluoro-4-piperidin-1-ylphenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(3-fluoro-4-piperidin-1-ylphenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3942490 |
| Molecular Formula | C15H16FN3OS |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-amino-5-[(3-fluoro-4-piperidin-1-ylphenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)C(=Cc2ccc(N3CCCCC3)c(F)c2)S1 |
| InChI | InChI=1S/C15H16FN3OS/c16-11-8-10(9-13-14(20)18-15(17)21-13)4-5-12(11)19-6-2-1-3-7-19/h4-5,8-9H,1-3,6-7H2,(H2,17,18,20) |
| InChIKey | NVUMUVKTUYIVRO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|