C20H17F2N3OS — CID 137076549
(5Z)-2-(4-fluorophenyl)imino-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137076549) has the molecular formula C20H17F2N3OS and a molecular weight of 385.44 g/mol. Its IUPAC name is (5Z)-2-(4-fluorophenyl)imino-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(4-fluorophenyl)imino-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137076549 |
| Molecular Formula | C20H17F2N3OS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (5Z)-2-(4-fluorophenyl)imino-5-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(F)cc2)S/C1=C\c1ccc(N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C20H17F2N3OS/c21-14-4-6-15(7-5-14)23-20-24-19(26)18(27-20)12-13-3-8-17(16(22)11-13)25-9-1-2-10-25/h3-8,11-12H,1-2,9-10H2,(H,23,24,26)/b18-12- |
| InChIKey | ZLSNDPAYQDVVDL-PDGQHHTCSA-N |
| XLogP | 4.46 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|