C23H24FN3OS — CID 135431995
2-(3,5-dimethylphenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135431995) has the molecular formula C23H24FN3OS and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,5-dimethylphenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135431995 |
| Molecular Formula | C23H24FN3OS |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(3,5-dimethylphenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2\NC(=O)C(=Cc3cc(F)c(N4CCCC4)cc3C)S2)c1 |
| InChI | InChI=1S/C23H24FN3OS/c1-14-8-15(2)10-18(9-14)25-23-26-22(28)21(29-23)13-17-12-19(24)20(11-16(17)3)27-6-4-5-7-27/h8-13H,4-7H2,1-3H3,(H,25,26,28) |
| InChIKey | OECJAVRUVUEKRA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|