C20H20BrN3O2S — CID 137173869
(5Z)-5-[(4-bromo-5-pyrrolidin-1-ylfuran-2-yl)methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137173869) has the molecular formula C20H20BrN3O2S and a molecular weight of 446.37 g/mol. Its IUPAC name is (5Z)-5-[(4-bromo-5-pyrrolidin-1-ylfuran-2-yl)methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(4-bromo-5-pyrrolidin-1-ylfuran-2-yl)methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137173869 |
| Molecular Formula | C20H20BrN3O2S |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | (5Z)-5-[(4-bromo-5-pyrrolidin-1-ylfuran-2-yl)methylidene]-2-(3,5-dimethylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)cc(/N=C2\NC(=O)/C(=C/c3cc(Br)c(N4CCCC4)o3)S2)c1 |
| InChI | InChI=1S/C20H20BrN3O2S/c1-12-7-13(2)9-14(8-12)22-20-23-18(25)17(27-20)11-15-10-16(21)19(26-15)24-5-3-4-6-24/h7-11H,3-6H2,1-2H3,(H,22,23,25)/b17-11- |
| InChIKey | KAJQHROXTHIYJK-BOPFTXTBSA-N |
| XLogP | 5.15 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|