C21H19ClFN3OS — CID 137137597
(5Z)-2-(3-chlorophenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137137597) has the molecular formula C21H19ClFN3OS and a molecular weight of 415.92 g/mol. Its IUPAC name is (5Z)-2-(3-chlorophenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chlorophenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137137597 |
| Molecular Formula | C21H19ClFN3OS |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | (5Z)-2-(3-chlorophenyl)imino-5-[(5-fluoro-2-methyl-4-pyrrolidin-1-ylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(N2CCCC2)c(F)cc1/C=C1\S/C(=N/c2cccc(Cl)c2)NC1=O |
| InChI | InChI=1S/C21H19ClFN3OS/c1-13-9-18(26-7-2-3-8-26)17(23)10-14(13)11-19-20(27)25-21(28-19)24-16-6-4-5-15(22)12-16/h4-6,9-12H,2-3,7-8H2,1H3,(H,24,25,27)/b19-11- |
| InChIKey | NYNAJZSVRBNZHU-ODLFYWEKSA-N |
| XLogP | 5.28 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|