C20H15ClF3N3O2S — CID 138111920
5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 138111920) has the molecular formula C20H15ClF3N3O2S and a molecular weight of 453.87 g/mol. Its IUPAC name is 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 138111920 |
| Molecular Formula | C20H15ClF3N3O2S |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCOCC2)SC1=Cc1ccc(-c2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C20H15ClF3N3O2S/c21-15-10-14(20(22,23)24)11-25-17(15)13-3-1-12(2-4-13)9-16-18(28)26-19(30-16)27-5-7-29-8-6-27/h1-4,9-11H,5-8H2 |
| InChIKey | JFSANVLFQAQBQF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|