C18H13ClF3N3OS — CID 138111951
5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-(dimethylamino)-1,3-thiazol-4-one (PubChem CID 138111951) has the molecular formula C18H13ClF3N3OS and a molecular weight of 411.84 g/mol. Its IUPAC name is 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-(dimethylamino)-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-(dimethylamino)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 138111951 |
| Molecular Formula | C18H13ClF3N3OS |
| Molecular Weight | 411.84 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 5-[[4-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]phenyl]methylidene]-2-(dimethylamino)-1,3-thiazol-4-one |
| SMILES | CN(C)C1=NC(=O)C(=Cc2ccc(-c3ncc(C(F)(F)F)cc3Cl)cc2)S1 |
| InChI | InChI=1S/C18H13ClF3N3OS/c1-25(2)17-24-16(26)14(27-17)7-10-3-5-11(6-4-10)15-13(19)8-12(9-23-15)18(20,21)22/h3-9H,1-2H3 |
| InChIKey | OLVKSRZTQFAQCB-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|