C17H13ClF3N5OS2 — CID 69014207
2-[4-(4-chloro-1,2,5-thiadiazol-3-yl)piperazin-1-yl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 69014207) has the molecular formula C17H13ClF3N5OS2 and a molecular weight of 459.91 g/mol. Its IUPAC name is 2-[4-(4-chloro-1,2,5-thiadiazol-3-yl)piperazin-1-yl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(4-chloro-1,2,5-thiadiazol-3-yl)piperazin-1-yl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 69014207 |
| Molecular Formula | C17H13ClF3N5OS2 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | 2-[4-(4-chloro-1,2,5-thiadiazol-3-yl)piperazin-1-yl]-5-[[4-(trifluoromethyl)phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCN(c3nsnc3Cl)CC2)SC1=Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF3N5OS2/c18-13-14(24-29-23-13)25-5-7-26(8-6-25)16-22-15(27)12(28-16)9-10-1-3-11(4-2-10)17(19,20)21/h1-4,9H,5-8H2 |
| InChIKey | GRJJKVFDEPNIQU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|