C29H28O8 — CID 10625322
dimethyl 5-[9-[3,5-bis(methoxycarbonyl)phenyl]nona-1,8-diynyl]benzene-1,3-dicarboxylate (PubChem CID 10625322) has the molecular formula C29H28O8 and a molecular weight of 504.54 g/mol. Its IUPAC name is dimethyl 5-[9-[3,5-bis(methoxycarbonyl)phenyl]nona-1,8-diynyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[9-[3,5-bis(methoxycarbonyl)phenyl]nona-1,8-diynyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 10625322 |
| Molecular Formula | C29H28O8 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | dimethyl 5-[9-[3,5-bis(methoxycarbonyl)phenyl]nona-1,8-diynyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C#CCCCCCC#Cc2cc(C(=O)OC)cc(C(=O)OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C29H28O8/c1-34-26(30)22-14-20(15-23(18-22)27(31)35-2)12-10-8-6-5-7-9-11-13-21-16-24(28(32)36-3)19-25(17-21)29(33)37-4/h14-19H,5-9H2,1-4H3 |
| InChIKey | XNMRVHGQTURUAR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|