C29H24O8 — CID 66556663
dimethyl 5-[2-[3-[2-[3,5-bis(methoxycarbonyl)phenyl]ethynyl]-1-bicyclo[1.1.1]pentanyl]ethynyl]benzene-1,3-dicarboxylate (PubChem CID 66556663) has the molecular formula C29H24O8 and a molecular weight of 500.50 g/mol. Its IUPAC name is dimethyl 5-[2-[3-[2-[3,5-bis(methoxycarbonyl)phenyl]ethynyl]-1-bicyclo[1.1.1]pentanyl]ethynyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[3-[2-[3,5-bis(methoxycarbonyl)phenyl]ethynyl]-1-bicyclo[1.1.1]pentanyl]ethynyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66556663 |
| Molecular Formula | C29H24O8 |
| Molecular Weight | 500.50 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | dimethyl 5-[2-[3-[2-[3,5-bis(methoxycarbonyl)phenyl]ethynyl]-1-bicyclo[1.1.1]pentanyl]ethynyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C#CC23CC(C#Cc4cc(C(=O)OC)cc(C(=O)OC)c4)(C2)C3)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C29H24O8/c1-34-24(30)20-9-18(10-21(13-20)25(31)35-2)5-7-28-15-29(16-28,17-28)8-6-19-11-22(26(32)36-3)14-23(12-19)27(33)37-4/h9-14H,15-17H2,1-4H3 |
| InChIKey | JMWWVSASSVPYAN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|