C21H30N3O4+ — CID 163738674
methyl 3-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-1H-pyrazol-2-ium-4-yl]benzoate (PubChem CID 163738674) has the molecular formula C21H30N3O4+ and a molecular weight of 388.49 g/mol. Its IUPAC name is methyl 3-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-1H-pyrazol-2-ium-4-yl]benzoate.
| Compound Name | methyl 3-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-1H-pyrazol-2-ium-4-yl]benzoate |
|---|---|
| PubChem CID | 163738674 |
| Molecular Formula | C21H30N3O4+ |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | methyl 3-[2-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]-1H-pyrazol-2-ium-4-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2c[nH][n+](CCCCCNC(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C21H29N3O4/c1-21(2,3)28-20(26)22-11-6-5-7-12-24-15-18(14-23-24)16-9-8-10-17(13-16)19(25)27-4/h8-10,13-15H,5-7,11-12H2,1-4H3,(H,22,26)/p+1 |
| InChIKey | LFWJNGSCCQPWEY-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|