C22H31ClN6O4 — CID 87338675
methyl 3-[[4-chloro-6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 87338675) has the molecular formula C22H31ClN6O4 and a molecular weight of 478.98 g/mol. Its IUPAC name is methyl 3-[[4-chloro-6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 3-[[4-chloro-6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 87338675 |
| Molecular Formula | C22H31ClN6O4 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | methyl 3-[[4-chloro-6-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylamino]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(Cl)nc(NCCCCCCNC(=O)OC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C22H31ClN6O4/c1-22(2,3)33-21(31)25-13-8-6-5-7-12-24-19-27-18(23)28-20(29-19)26-16-11-9-10-15(14-16)17(30)32-4/h9-11,14H,5-8,12-13H2,1-4H3,(H,25,31)(H2,24,26,27,28,29) |
| InChIKey | CUWJBDKYHUWFIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|