C29H40O8 — CID 21265732
dimethyl 2,2-bis[[4-(diethoxymethyl)phenyl]methyl]propanedioate (PubChem CID 21265732) has the molecular formula C29H40O8 and a molecular weight of 516.63 g/mol. Its IUPAC name is dimethyl 2,2-bis[[4-(diethoxymethyl)phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2,2-bis[[4-(diethoxymethyl)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 21265732 |
| Molecular Formula | C29H40O8 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | dimethyl 2,2-bis[[4-(diethoxymethyl)phenyl]methyl]propanedioate |
| SMILES | CCOC(OCC)c1ccc(CC(Cc2ccc(C(OCC)OCC)cc2)(C(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C29H40O8/c1-7-34-25(35-8-2)23-15-11-21(12-16-23)19-29(27(30)32-5,28(31)33-6)20-22-13-17-24(18-14-22)26(36-9-3)37-10-4/h11-18,25-26H,7-10,19-20H2,1-6H3 |
| InChIKey | GPYRVMKOKDIERY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|