C18H23F2NO — CID 145210804
2-(2,4-difluorophenyl)-4-methoxypyridine;2,3-dimethylbutane (PubChem CID 145210804) has the molecular formula C18H23F2NO and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-methoxypyridine;2,3-dimethylbutane.
| Compound Name | 2-(2,4-difluorophenyl)-4-methoxypyridine;2,3-dimethylbutane |
|---|---|
| PubChem CID | 145210804 |
| Molecular Formula | C18H23F2NO |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-methoxypyridine;2,3-dimethylbutane |
| SMILES | CC(C)C(C)C.COc1ccnc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C12H9F2NO.C6H14/c1-16-9-4-5-15-12(7-9)10-3-2-8(13)6-11(10)14;1-5(2)6(3)4/h2-7H,1H3;5-6H,1-4H3 |
| InChIKey | HABDJIBYISZTPC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |