C11H8F2N2O — CID 141051307
2-(2,4-difluorophenyl)-4-methoxypyrimidine (PubChem CID 141051307) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4-methoxypyrimidine.
| Compound Name | 2-(2,4-difluorophenyl)-4-methoxypyrimidine |
|---|---|
| PubChem CID | 141051307 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4-methoxypyrimidine |
| SMILES | COc1ccnc(-c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C11H8F2N2O/c1-16-10-4-5-14-11(15-10)8-3-2-7(12)6-9(8)13/h2-6H,1H3 |
| InChIKey | WNFJODDTBDOSKE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |