C20H21F2IN4 — CID 159317842
2-(2,4-difluorophenyl)-N,N-dimethylpyridin-4-amine;2-iodo-N,N-dimethylpyridin-4-amine (PubChem CID 159317842) has the molecular formula C20H21F2IN4 and a molecular weight of 482.32 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-N,N-dimethylpyridin-4-amine;2-iodo-N,N-dimethylpyridin-4-amine.
| Compound Name | 2-(2,4-difluorophenyl)-N,N-dimethylpyridin-4-amine;2-iodo-N,N-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 159317842 |
| Molecular Formula | C20H21F2IN4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-N,N-dimethylpyridin-4-amine;2-iodo-N,N-dimethylpyridin-4-amine |
| SMILES | CN(C)c1ccnc(-c2ccc(F)cc2F)c1.CN(C)c1ccnc(I)c1 |
| InChI | InChI=1S/C13H12F2N2.C7H9IN2/c1-17(2)10-5-6-16-13(8-10)11-4-3-9(14)7-12(11)15;1-10(2)6-3-4-9-7(8)5-6/h3-8H,1-2H3;3-5H,1-2H3 |
| InChIKey | LDJIEPVSHSYYEA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|